C13H16N2 — CID 129415806
(3S,4S)-4-(4-ethylphenyl)pyrrolidine-3-carbonitrile (PubChem CID 129415806) has the molecular formula C13H16N2 and a molecular weight of 200.28 g/mol. Its IUPAC name is (3S,4S)-4-(4-ethylphenyl)pyrrolidine-3-carbonitrile.
| Compound Name | (3S,4S)-4-(4-ethylphenyl)pyrrolidine-3-carbonitrile |
|---|---|
| PubChem CID | 129415806 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | (3S,4S)-4-(4-ethylphenyl)pyrrolidine-3-carbonitrile |
| SMILES | CCc1ccc([C@H]2CNC[C@H]2C#N)cc1 |
| InChI | InChI=1S/C13H16N2/c1-2-10-3-5-11(6-4-10)13-9-15-8-12(13)7-14/h3-6,12-13,15H,2,8-9H2,1H3/t12-,13-/m1/s1 |
| InChIKey | IUFKSZCTVSOPAA-CHWSQXEVSA-N |
| XLogP | 2.08 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |