C20H21N3O3 — CID 129416402
(6-methoxy-1H-indol-2-yl)-[(3R)-3-[(5-methyl-2-pyridinyl)oxy]pyrrolidin-1-yl]methanone (PubChem CID 129416402) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is (6-methoxy-1H-indol-2-yl)-[(3R)-3-[(5-methyl-2-pyridinyl)oxy]pyrrolidin-1-yl]methanone.
| Compound Name | (6-methoxy-1H-indol-2-yl)-[(3R)-3-[(5-methyl-2-pyridinyl)oxy]pyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 129416402 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | (6-methoxy-1H-indol-2-yl)-[(3R)-3-[(5-methyl-2-pyridinyl)oxy]pyrrolidin-1-yl]methanone |
| SMILES | COc1ccc2cc(C(=O)N3CC[C@@H](Oc4ccc(C)cn4)C3)[nH]c2c1 |
| InChI | InChI=1S/C20H21N3O3/c1-13-3-6-19(21-11-13)26-16-7-8-23(12-16)20(24)18-9-14-4-5-15(25-2)10-17(14)22-18/h3-6,9-11,16,22H,7-8,12H2,1-2H3/t16-/m1/s1 |
| InChIKey | CIAPNRDWMJDKJT-MRXNPFEDSA-N |
| XLogP | 3.17 |
| TPSA | 67.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |