C16H17N3O3 — CID 129417447
5-[(2S)-oxolane-2-carbonyl]-1,5,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraen-2-one (PubChem CID 129417447) has the molecular formula C16H17N3O3 and a molecular weight of 299.33 g/mol. Its IUPAC name is 5-[(2S)-oxolane-2-carbonyl]-1,5,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraen-2-one.
| Compound Name | 5-[(2S)-oxolane-2-carbonyl]-1,5,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraen-2-one |
|---|---|
| PubChem CID | 129417447 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 5-[(2S)-oxolane-2-carbonyl]-1,5,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),9,11,13-tetraen-2-one |
| SMILES | O=C([C@@H]1CCCO1)N1CCc2nc3ccccn3c(=O)c2C1 |
| InChI | InChI=1S/C16H17N3O3/c20-15-11-10-18(16(21)13-4-3-9-22-13)8-6-12(11)17-14-5-1-2-7-19(14)15/h1-2,5,7,13H,3-4,6,8-10H2/t13-/m0/s1 |
| InChIKey | OTVRMPYVFZQIFF-ZDUSSCGKSA-N |
| XLogP | 0.76 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |