About 11-amino-2,12-dimethyl-2-propylpentadecan-1-ol
11-amino-2,12-dimethyl-2-propylpentadecan-1-ol (PubChem CID 12941766) has the molecular formula C20H43NO
and a molecular weight of 313.57 g/mol. Its IUPAC name is 11-amino-2,12-dimethyl-2-propylpentadecan-1-ol.
Molecular Properties
| Compound Name | 11-amino-2,12-dimethyl-2-propylpentadecan-1-ol |
| PubChem CID | 12941766 |
| Molecular Formula | C20H43NO |
| Molecular Weight | 313.57 g/mol |
| Exact Mass | 313.33 |
| IUPAC Name | 11-amino-2,12-dimethyl-2-propylpentadecan-1-ol |
| SMILES | CCCC(C)C(N)CCCCCCCCC(C)(CO)CCC |
| InChI | InChI=1S/C20H43NO/c1-5-13-18(3)19(21)14-11-9-7-8-10-12-16-20(4,17-22)15-6-2/h18-19,22H,5-17,21H2,1-4H3 |
| InChIKey | CNESSQZYZZWNDC-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 313.57 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 11-amino-2,12-dimethyl-2-propylpentadecan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-amino-2,12-dimethyl-2-propylpentadecan-1-ol?
The IUPAC name of 11-amino-2,12-dimethyl-2-propylpentadecan-1-ol (CID 12941766) is 11-amino-2,12-dimethyl-2-propylpentadecan-1-ol.
What is the SMILES notation for 11-amino-2,12-dimethyl-2-propylpentadecan-1-ol?
The canonical SMILES for 11-amino-2,12-dimethyl-2-propylpentadecan-1-ol is CCCC(C)C(N)CCCCCCCCC(C)(CO)CCC.
What is the InChIKey of 11-amino-2,12-dimethyl-2-propylpentadecan-1-ol?
The InChIKey is CNESSQZYZZWNDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H43NO/c1-5-13-18(3)19(21)14-11-9-7-8-10-12-16-20(4,17-22)15-6-2/h18-19,22H,5-17,21H2,1-4H3.
What are the key properties of 11-amino-2,12-dimethyl-2-propylpentadecan-1-ol?
11-amino-2,12-dimethyl-2-propylpentadecan-1-ol has a molecular weight of 313.57 g/mol, XLogP of 5.67, 15 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 11-amino-2,12-dimethyl-2-propylpentadecan-1-ol is sourced from PubChem (CID 12941766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).