C18H28N4O4 — CID 129417699
tert-butyl N-[3-[[(6R)-2-methyl-3-oxo-5,6,7,8-tetrahydrocinnoline-6-carbonyl]amino]propyl]carbamate (PubChem CID 129417699) has the molecular formula C18H28N4O4 and a molecular weight of 364.45 g/mol. Its IUPAC name is tert-butyl N-[3-[[(6R)-2-methyl-3-oxo-5,6,7,8-tetrahydrocinnoline-6-carbonyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[(6R)-2-methyl-3-oxo-5,6,7,8-tetrahydrocinnoline-6-carbonyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 129417699 |
| Molecular Formula | C18H28N4O4 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | tert-butyl N-[3-[[(6R)-2-methyl-3-oxo-5,6,7,8-tetrahydrocinnoline-6-carbonyl]amino]propyl]carbamate |
| SMILES | Cn1nc2c(cc1=O)C[C@H](C(=O)NCCCNC(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C18H28N4O4/c1-18(2,3)26-17(25)20-9-5-8-19-16(24)12-6-7-14-13(10-12)11-15(23)22(4)21-14/h11-12H,5-10H2,1-4H3,(H,19,24)(H,20,25)/t12-/m1/s1 |
| InChIKey | RKZSTRNRRUYLML-GFCCVEGCSA-N |
| XLogP | 0.92 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|