C17H21N7O3S — CID 129418249
(2R)-2-acetamido-N-[[7-(3-methyl-1,2,4-oxadiazol-5-yl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]-4-methylsulfanylbutanamide (PubChem CID 129418249) has the molecular formula C17H21N7O3S and a molecular weight of 403.47 g/mol. Its IUPAC name is (2R)-2-acetamido-N-[[7-(3-methyl-1,2,4-oxadiazol-5-yl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]-4-methylsulfanylbutanamide.
| Compound Name | (2R)-2-acetamido-N-[[7-(3-methyl-1,2,4-oxadiazol-5-yl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 129418249 |
| Molecular Formula | C17H21N7O3S |
| Molecular Weight | 403.47 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | (2R)-2-acetamido-N-[[7-(3-methyl-1,2,4-oxadiazol-5-yl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]-4-methylsulfanylbutanamide |
| SMILES | CSCC[C@@H](NC(C)=O)C(=O)NCc1nnc2cc(-c3nc(C)no3)ccn12 |
| InChI | InChI=1S/C17H21N7O3S/c1-10-19-17(27-23-10)12-4-6-24-14(8-12)21-22-15(24)9-18-16(26)13(5-7-28-3)20-11(2)25/h4,6,8,13H,5,7,9H2,1-3H3,(H,18,26)(H,20,25)/t13-/m1/s1 |
| InChIKey | YYMALMPAKNOSSC-CYBMUJFWSA-N |
| XLogP | 0.96 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.47 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |