About (2R)-2-butyl-3-oxo-4H-1,4-benzoxazine-6-sulfonyl chloride
(2R)-2-butyl-3-oxo-4H-1,4-benzoxazine-6-sulfonyl chloride (PubChem CID 129418539) has the molecular formula C12H14ClNO4S
and a molecular weight of 303.77 g/mol. Its IUPAC name is (2R)-2-butyl-3-oxo-4H-1,4-benzoxazine-6-sulfonyl chloride.
Molecular Properties
| Compound Name | (2R)-2-butyl-3-oxo-4H-1,4-benzoxazine-6-sulfonyl chloride |
| PubChem CID | 129418539 |
| Molecular Formula | C12H14ClNO4S |
| Molecular Weight | 303.77 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | (2R)-2-butyl-3-oxo-4H-1,4-benzoxazine-6-sulfonyl chloride |
| SMILES | CCCC[C@H]1Oc2ccc(S(=O)(=O)Cl)cc2NC1=O |
| InChI | InChI=1S/C12H14ClNO4S/c1-2-3-4-11-12(15)14-9-7-8(19(13,16)17)5-6-10(9)18-11/h5-7,11H,2-4H2,1H3,(H,14,15)/t11-/m1/s1 |
| InChIKey | HGSJPSMJFFCTHP-LLVKDONJSA-N |
| XLogP | 2.50 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.77 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-2-butyl-3-oxo-4H-1,4-benzoxazine-6-sulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-butyl-3-oxo-4H-1,4-benzoxazine-6-sulfonyl chloride?
The IUPAC name of (2R)-2-butyl-3-oxo-4H-1,4-benzoxazine-6-sulfonyl chloride (CID 129418539) is (2R)-2-butyl-3-oxo-4H-1,4-benzoxazine-6-sulfonyl chloride.
What is the SMILES notation for (2R)-2-butyl-3-oxo-4H-1,4-benzoxazine-6-sulfonyl chloride?
The canonical SMILES for (2R)-2-butyl-3-oxo-4H-1,4-benzoxazine-6-sulfonyl chloride is CCCC[C@H]1Oc2ccc(S(=O)(=O)Cl)cc2NC1=O.
What is the InChIKey of (2R)-2-butyl-3-oxo-4H-1,4-benzoxazine-6-sulfonyl chloride?
The InChIKey is HGSJPSMJFFCTHP-LLVKDONJSA-N. The full InChI is InChI=1S/C12H14ClNO4S/c1-2-3-4-11-12(15)14-9-7-8(19(13,16)17)5-6-10(9)18-11/h5-7,11H,2-4H2,1H3,(H,14,15)/t11-/m1/s1.
What are the key properties of (2R)-2-butyl-3-oxo-4H-1,4-benzoxazine-6-sulfonyl chloride?
(2R)-2-butyl-3-oxo-4H-1,4-benzoxazine-6-sulfonyl chloride has a molecular weight of 303.77 g/mol, XLogP of 2.50, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-butyl-3-oxo-4H-1,4-benzoxazine-6-sulfonyl chloride is sourced from PubChem (CID 129418539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).