C27H28N2O3S — CID 129419509
(3S,4S)-2-(2-methoxyethyl)-1-oxo-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]-3-thiophen-2-yl-3,4-dihydroisoquinoline-4-carboxamide (PubChem CID 129419509) has the molecular formula C27H28N2O3S and a molecular weight of 460.60 g/mol. Its IUPAC name is (3S,4S)-2-(2-methoxyethyl)-1-oxo-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]-3-thiophen-2-yl-3,4-dihydroisoquinoline-4-carboxamide.
| Compound Name | (3S,4S)-2-(2-methoxyethyl)-1-oxo-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]-3-thiophen-2-yl-3,4-dihydroisoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 129419509 |
| Molecular Formula | C27H28N2O3S |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | (3S,4S)-2-(2-methoxyethyl)-1-oxo-N-[(1S)-1,2,3,4-tetrahydronaphthalen-1-yl]-3-thiophen-2-yl-3,4-dihydroisoquinoline-4-carboxamide |
| SMILES | COCCN1C(=O)c2ccccc2[C@H](C(=O)N[C@H]2CCCc3ccccc32)[C@H]1c1cccs1 |
| InChI | InChI=1S/C27H28N2O3S/c1-32-16-15-29-25(23-14-7-17-33-23)24(20-11-4-5-12-21(20)27(29)31)26(30)28-22-13-6-9-18-8-2-3-10-19(18)22/h2-5,7-8,10-12,14,17,22,24-25H,6,9,13,15-16H2,1H3,(H,28,30)/t22-,24-,25+/m0/s1 |
| InChIKey | UUVGYSVKTOOLAO-ZKMPZPQNSA-N |
| XLogP | 4.87 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |