C27H34N2O4S — CID 129419613
(3R,4S)-4-[(3R,5R)-3,5-dimethylpiperidine-1-carbonyl]-6,7-dimethoxy-2-methyl-3-(4-methylsulfanylphenyl)-3,4-dihydroisoquinolin-1-one (PubChem CID 129419613) has the molecular formula C27H34N2O4S and a molecular weight of 482.65 g/mol. Its IUPAC name is (3R,4S)-4-[(3R,5R)-3,5-dimethylpiperidine-1-carbonyl]-6,7-dimethoxy-2-methyl-3-(4-methylsulfanylphenyl)-3,4-dihydroisoquinolin-1-one.
| Compound Name | (3R,4S)-4-[(3R,5R)-3,5-dimethylpiperidine-1-carbonyl]-6,7-dimethoxy-2-methyl-3-(4-methylsulfanylphenyl)-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 129419613 |
| Molecular Formula | C27H34N2O4S |
| Molecular Weight | 482.65 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | (3R,4S)-4-[(3R,5R)-3,5-dimethylpiperidine-1-carbonyl]-6,7-dimethoxy-2-methyl-3-(4-methylsulfanylphenyl)-3,4-dihydroisoquinolin-1-one |
| SMILES | COc1cc2c(cc1OC)[C@H](C(=O)N1C[C@H](C)C[C@@H](C)C1)[C@H](c1ccc(SC)cc1)N(C)C2=O |
| InChI | InChI=1S/C27H34N2O4S/c1-16-11-17(2)15-29(14-16)27(31)24-20-12-22(32-4)23(33-5)13-21(20)26(30)28(3)25(24)18-7-9-19(34-6)10-8-18/h7-10,12-13,16-17,24-25H,11,14-15H2,1-6H3/t16-,17-,24+,25+/m1/s1 |
| InChIKey | CFKHOECCTVOMPT-NXIIPSDBSA-N |
| XLogP | 4.84 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.65 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |