C19H23N3O6S — CID 129421174
(3S,4R)-N-[2-(2-methoxyphenyl)ethyl]-2-methyl-3-(3-nitrophenyl)-1,2-oxazolidine-4-sulfonamide (PubChem CID 129421174) has the molecular formula C19H23N3O6S and a molecular weight of 421.48 g/mol. Its IUPAC name is (3S,4R)-N-[2-(2-methoxyphenyl)ethyl]-2-methyl-3-(3-nitrophenyl)-1,2-oxazolidine-4-sulfonamide.
| Compound Name | (3S,4R)-N-[2-(2-methoxyphenyl)ethyl]-2-methyl-3-(3-nitrophenyl)-1,2-oxazolidine-4-sulfonamide |
|---|---|
| PubChem CID | 129421174 |
| Molecular Formula | C19H23N3O6S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | (3S,4R)-N-[2-(2-methoxyphenyl)ethyl]-2-methyl-3-(3-nitrophenyl)-1,2-oxazolidine-4-sulfonamide |
| SMILES | COc1ccccc1CCNS(=O)(=O)[C@H]1CON(C)[C@H]1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H23N3O6S/c1-21-19(15-7-5-8-16(12-15)22(23)24)18(13-28-21)29(25,26)20-11-10-14-6-3-4-9-17(14)27-2/h3-9,12,18-20H,10-11,13H2,1-2H3/t18-,19-/m0/s1 |
| InChIKey | UARRWJKMGPKKDW-OALUTQOASA-N |
| XLogP | 2.05 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|