C11H13IO — CID 129421495
(1R,2R,3S,4R,5R,6R,7S,8R,9R,10S)-7-iodopentacyclo[6.3.0.02,6.03,10.05,9]undecan-4-ol (PubChem CID 129421495) has the molecular formula C11H13IO and a molecular weight of 288.13 g/mol. Its IUPAC name is (1R,2R,3S,4R,5R,6R,7S,8R,9R,10S)-7-iodopentacyclo[6.3.0.02,6.03,10.05,9]undecan-4-ol.
| Compound Name | (1R,2R,3S,4R,5R,6R,7S,8R,9R,10S)-7-iodopentacyclo[6.3.0.02,6.03,10.05,9]undecan-4-ol |
|---|---|
| PubChem CID | 129421495 |
| Molecular Formula | C11H13IO |
| Molecular Weight | 288.13 g/mol |
| Exact Mass | 288.00 |
| IUPAC Name | (1R,2R,3S,4R,5R,6R,7S,8R,9R,10S)-7-iodopentacyclo[6.3.0.02,6.03,10.05,9]undecan-4-ol |
| SMILES | O[C@H]1[C@H]2[C@@H]3[C@@H](I)[C@@H]4[C@@H]5C[C@@H]([C@H]24)[C@H]1[C@@H]53 |
| InChI | InChI=1S/C11H13IO/c12-10-6-2-1-3-4(6)9-8(10)5(2)7(3)11(9)13/h2-11,13H,1H2/t2-,3+,4+,5-,6-,7+,8-,9-,10+,11-/m1/s1 |
| InChIKey | RXTXQWBRGIFYJK-FOOPBILSSA-N |
| XLogP | 1.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.13 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|