C14H23N3O2 — CID 129422026
(1R,5R,6R)-N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-N,7,7-trimethyl-2-oxabicyclo[3.2.0]heptan-6-amine (PubChem CID 129422026) has the molecular formula C14H23N3O2 and a molecular weight of 265.36 g/mol. Its IUPAC name is (1R,5R,6R)-N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-N,7,7-trimethyl-2-oxabicyclo[3.2.0]heptan-6-amine.
| Compound Name | (1R,5R,6R)-N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-N,7,7-trimethyl-2-oxabicyclo[3.2.0]heptan-6-amine |
|---|---|
| PubChem CID | 129422026 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | (1R,5R,6R)-N-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]-N,7,7-trimethyl-2-oxabicyclo[3.2.0]heptan-6-amine |
| SMILES | CCc1nc(CN(C)[C@@H]2[C@H]3CCO[C@H]3C2(C)C)no1 |
| InChI | InChI=1S/C14H23N3O2/c1-5-11-15-10(16-19-11)8-17(4)12-9-6-7-18-13(9)14(12,2)3/h9,12-13H,5-8H2,1-4H3/t9-,12-,13-/m1/s1 |
| InChIKey | GCSLMGCGKMZQEL-OASPWFOLSA-N |
| XLogP | 1.88 |
| TPSA | 51.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |