C18H25N3O2 — CID 129422245
(3R)-1,3-dimethyl-N-[(1R,2S,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]-3,5-dihydro-2H-1,4-benzodiazepine-4-carboxamide (PubChem CID 129422245) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is (3R)-1,3-dimethyl-N-[(1R,2S,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]-3,5-dihydro-2H-1,4-benzodiazepine-4-carboxamide.
| Compound Name | (3R)-1,3-dimethyl-N-[(1R,2S,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]-3,5-dihydro-2H-1,4-benzodiazepine-4-carboxamide |
|---|---|
| PubChem CID | 129422245 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | (3R)-1,3-dimethyl-N-[(1R,2S,4R)-7-oxabicyclo[2.2.1]heptan-2-yl]-3,5-dihydro-2H-1,4-benzodiazepine-4-carboxamide |
| SMILES | C[C@@H]1CN(C)c2ccccc2CN1C(=O)N[C@H]1C[C@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C18H25N3O2/c1-12-10-20(2)16-6-4-3-5-13(16)11-21(12)18(22)19-15-9-14-7-8-17(15)23-14/h3-6,12,14-15,17H,7-11H2,1-2H3,(H,19,22)/t12-,14-,15+,17-/m1/s1 |
| InChIKey | ITCHTLCTQHPZPA-JJAZEVLHSA-N |
| XLogP | 2.36 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |