C20H27FN4 — CID 129422390
(7S,8aS)-N-[(1S)-1-[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]ethyl]-1,2,3,5,6,7,8,8a-octahydroindolizin-7-amine (PubChem CID 129422390) has the molecular formula C20H27FN4 and a molecular weight of 342.46 g/mol. Its IUPAC name is (7S,8aS)-N-[(1S)-1-[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]ethyl]-1,2,3,5,6,7,8,8a-octahydroindolizin-7-amine.
| Compound Name | (7S,8aS)-N-[(1S)-1-[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]ethyl]-1,2,3,5,6,7,8,8a-octahydroindolizin-7-amine |
|---|---|
| PubChem CID | 129422390 |
| Molecular Formula | C20H27FN4 |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | (7S,8aS)-N-[(1S)-1-[3-fluoro-4-(2-methylimidazol-1-yl)phenyl]ethyl]-1,2,3,5,6,7,8,8a-octahydroindolizin-7-amine |
| SMILES | Cc1nccn1-c1ccc([C@H](C)N[C@H]2CCN3CCC[C@H]3C2)cc1F |
| InChI | InChI=1S/C20H27FN4/c1-14(23-17-7-10-24-9-3-4-18(24)13-17)16-5-6-20(19(21)12-16)25-11-8-22-15(25)2/h5-6,8,11-12,14,17-18,23H,3-4,7,9-10,13H2,1-2H3/t14-,17-,18-/m0/s1 |
| InChIKey | KGEIHHUWMJPNNI-WBAXXEDZSA-N |
| XLogP | 3.60 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |