C15H20N6O2S — CID 129422400
2-N-[[(2S,3R)-1-methyl-2-thiophen-2-ylpiperidin-3-yl]methyl]-5-nitropyrimidine-2,4-diamine (PubChem CID 129422400) has the molecular formula C15H20N6O2S and a molecular weight of 348.43 g/mol. Its IUPAC name is 2-N-[[(2S,3R)-1-methyl-2-thiophen-2-ylpiperidin-3-yl]methyl]-5-nitropyrimidine-2,4-diamine.
| Compound Name | 2-N-[[(2S,3R)-1-methyl-2-thiophen-2-ylpiperidin-3-yl]methyl]-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 129422400 |
| Molecular Formula | C15H20N6O2S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 2-N-[[(2S,3R)-1-methyl-2-thiophen-2-ylpiperidin-3-yl]methyl]-5-nitropyrimidine-2,4-diamine |
| SMILES | CN1CCC[C@H](CNc2ncc([N+](=O)[O-])c(N)n2)[C@H]1c1cccs1 |
| InChI | InChI=1S/C15H20N6O2S/c1-20-6-2-4-10(13(20)12-5-3-7-24-12)8-17-15-18-9-11(21(22)23)14(16)19-15/h3,5,7,9-10,13H,2,4,6,8H2,1H3,(H3,16,17,18,19)/t10-,13+/m1/s1 |
| InChIKey | KIZGVNQVNBGSTA-MFKMUULPSA-N |
| XLogP | 2.52 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|