C20H27NO4 — CID 129423111
(2R)-1-[benzyl-[[(2R)-oxolan-2-yl]methyl]amino]-3-(furan-2-ylmethoxy)propan-2-ol (PubChem CID 129423111) has the molecular formula C20H27NO4 and a molecular weight of 345.44 g/mol. Its IUPAC name is (2R)-1-[benzyl-[[(2R)-oxolan-2-yl]methyl]amino]-3-(furan-2-ylmethoxy)propan-2-ol.
| Compound Name | (2R)-1-[benzyl-[[(2R)-oxolan-2-yl]methyl]amino]-3-(furan-2-ylmethoxy)propan-2-ol |
|---|---|
| PubChem CID | 129423111 |
| Molecular Formula | C20H27NO4 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | (2R)-1-[benzyl-[[(2R)-oxolan-2-yl]methyl]amino]-3-(furan-2-ylmethoxy)propan-2-ol |
| SMILES | O[C@@H](COCc1ccco1)CN(Cc1ccccc1)C[C@H]1CCCO1 |
| InChI | InChI=1S/C20H27NO4/c22-18(15-23-16-20-9-5-11-25-20)13-21(14-19-8-4-10-24-19)12-17-6-2-1-3-7-17/h1-3,5-7,9,11,18-19,22H,4,8,10,12-16H2/t18-,19-/m1/s1 |
| InChIKey | PRTCIEPZKJNDPS-RTBURBONSA-N |
| XLogP | 2.84 |
| TPSA | 55.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |