C19H23N3O4S — CID 129423737
N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-1-methyl-4-oxochromeno[3,4-d]imidazole-8-sulfonamide (PubChem CID 129423737) has the molecular formula C19H23N3O4S and a molecular weight of 389.48 g/mol. Its IUPAC name is N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-1-methyl-4-oxochromeno[3,4-d]imidazole-8-sulfonamide.
| Compound Name | N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-1-methyl-4-oxochromeno[3,4-d]imidazole-8-sulfonamide |
|---|---|
| PubChem CID | 129423737 |
| Molecular Formula | C19H23N3O4S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-1-methyl-4-oxochromeno[3,4-d]imidazole-8-sulfonamide |
| SMILES | C[C@H]1[C@H](C)CCC[C@H]1NS(=O)(=O)c1ccc2oc(=O)c3ncn(C)c3c2c1 |
| InChI | InChI=1S/C19H23N3O4S/c1-11-5-4-6-15(12(11)2)21-27(24,25)13-7-8-16-14(9-13)18-17(19(23)26-16)20-10-22(18)3/h7-12,15,21H,4-6H2,1-3H3/t11-,12+,15-/m1/s1 |
| InChIKey | PFDSVDDUBHMSPV-TYNCELHUSA-N |
| XLogP | 2.78 |
| TPSA | 94.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|