C10H13Cl2F3O2 — CID 12942377
methyl 3-(2,2-dichloro-3,3,3-trifluoropropyl)-2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 12942377) has the molecular formula C10H13Cl2F3O2 and a molecular weight of 293.11 g/mol. Its IUPAC name is methyl 3-(2,2-dichloro-3,3,3-trifluoropropyl)-2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | methyl 3-(2,2-dichloro-3,3,3-trifluoropropyl)-2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 12942377 |
| Molecular Formula | C10H13Cl2F3O2 |
| Molecular Weight | 293.11 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | methyl 3-(2,2-dichloro-3,3,3-trifluoropropyl)-2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | COC(=O)C1C(CC(Cl)(Cl)C(F)(F)F)C1(C)C |
| InChI | InChI=1S/C10H13Cl2F3O2/c1-8(2)5(6(8)7(16)17-3)4-9(11,12)10(13,14)15/h5-6H,4H2,1-3H3 |
| InChIKey | RIELLBIGLBNVIU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.11 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|