C17H23FN2O3 — CID 129424006
(3S,5R)-3-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-3-fluoroanilino]-5-methyloxolan-2-one (PubChem CID 129424006) has the molecular formula C17H23FN2O3 and a molecular weight of 322.38 g/mol. Its IUPAC name is (3S,5R)-3-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-3-fluoroanilino]-5-methyloxolan-2-one.
| Compound Name | (3S,5R)-3-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-3-fluoroanilino]-5-methyloxolan-2-one |
|---|---|
| PubChem CID | 129424006 |
| Molecular Formula | C17H23FN2O3 |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | (3S,5R)-3-[4-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-3-fluoroanilino]-5-methyloxolan-2-one |
| SMILES | C[C@@H]1C[C@H](Nc2ccc(N3C[C@@H](C)O[C@H](C)C3)c(F)c2)C(=O)O1 |
| InChI | InChI=1S/C17H23FN2O3/c1-10-6-15(17(21)23-10)19-13-4-5-16(14(18)7-13)20-8-11(2)22-12(3)9-20/h4-5,7,10-12,15,19H,6,8-9H2,1-3H3/t10-,11-,12-,15+/m1/s1 |
| InChIKey | RRNALEAXKDHPIT-BLTAXRJOSA-N |
| XLogP | 2.56 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|