C15H20N2O — CID 129424037
(2Z,4E)-1-[(2S)-2-(1-methylpyrrol-2-yl)pyrrolidin-1-yl]hexa-2,4-dien-1-one (PubChem CID 129424037) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is (2Z,4E)-1-[(2S)-2-(1-methylpyrrol-2-yl)pyrrolidin-1-yl]hexa-2,4-dien-1-one.
| Compound Name | (2Z,4E)-1-[(2S)-2-(1-methylpyrrol-2-yl)pyrrolidin-1-yl]hexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 129424037 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | (2Z,4E)-1-[(2S)-2-(1-methylpyrrol-2-yl)pyrrolidin-1-yl]hexa-2,4-dien-1-one |
| SMILES | C/C=C/C=C\C(=O)N1CCC[C@H]1c1cccn1C |
| InChI | InChI=1S/C15H20N2O/c1-3-4-5-10-15(18)17-12-7-9-14(17)13-8-6-11-16(13)2/h3-6,8,10-11,14H,7,9,12H2,1-2H3/b4-3+,10-5-/t14-/m0/s1 |
| InChIKey | SCIQQHYMHQQSET-XGAUUOQBSA-N |
| XLogP | 2.82 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|