C17H22N2O — CID 129424094
(E)-1-[(1S,6S)-9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl]-3-phenylprop-2-en-1-one (PubChem CID 129424094) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is (E)-1-[(1S,6S)-9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl]-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-[(1S,6S)-9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 129424094 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | (E)-1-[(1S,6S)-9-methyl-3,9-diazabicyclo[4.2.1]nonan-3-yl]-3-phenylprop-2-en-1-one |
| SMILES | CN1[C@H]2CC[C@H]1CN(C(=O)/C=C/c1ccccc1)CC2 |
| InChI | InChI=1S/C17H22N2O/c1-18-15-8-9-16(18)13-19(12-11-15)17(20)10-7-14-5-3-2-4-6-14/h2-7,10,15-16H,8-9,11-13H2,1H3/b10-7+/t15-,16-/m0/s1 |
| InChIKey | SLCKBKNDFCKMCE-MOVUHUBBSA-N |
| XLogP | 2.39 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|