C25H30FN5O2 — CID 129424210
(3S)-N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-1-[3-(4-fluorophenyl)-[1,2]oxazolo[5,4-d]pyrimidin-4-yl]piperidine-3-carboxamide (PubChem CID 129424210) has the molecular formula C25H30FN5O2 and a molecular weight of 451.55 g/mol. Its IUPAC name is (3S)-N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-1-[3-(4-fluorophenyl)-[1,2]oxazolo[5,4-d]pyrimidin-4-yl]piperidine-3-carboxamide.
| Compound Name | (3S)-N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-1-[3-(4-fluorophenyl)-[1,2]oxazolo[5,4-d]pyrimidin-4-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 129424210 |
| Molecular Formula | C25H30FN5O2 |
| Molecular Weight | 451.55 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | (3S)-N-[(1S,2S,3R)-2,3-dimethylcyclohexyl]-1-[3-(4-fluorophenyl)-[1,2]oxazolo[5,4-d]pyrimidin-4-yl]piperidine-3-carboxamide |
| SMILES | C[C@H]1[C@H](C)CCC[C@@H]1NC(=O)[C@H]1CCCN(c2ncnc3onc(-c4ccc(F)cc4)c23)C1 |
| InChI | InChI=1S/C25H30FN5O2/c1-15-5-3-7-20(16(15)2)29-24(32)18-6-4-12-31(13-18)23-21-22(17-8-10-19(26)11-9-17)30-33-25(21)28-14-27-23/h8-11,14-16,18,20H,3-7,12-13H2,1-2H3,(H,29,32)/t15-,16+,18+,20+/m1/s1 |
| InChIKey | AUHFQWNQIWLYRR-JMVFIXPQSA-N |
| XLogP | 4.58 |
| TPSA | 84.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.55 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |