C13H23N3O3S — CID 129425471
1-[[(2S)-1-[(2R)-1-methoxypropan-2-yl]sulfonylpyrrolidin-2-yl]methyl]-2-methylimidazole (PubChem CID 129425471) has the molecular formula C13H23N3O3S and a molecular weight of 301.41 g/mol. Its IUPAC name is 1-[[(2S)-1-[(2R)-1-methoxypropan-2-yl]sulfonylpyrrolidin-2-yl]methyl]-2-methylimidazole.
| Compound Name | 1-[[(2S)-1-[(2R)-1-methoxypropan-2-yl]sulfonylpyrrolidin-2-yl]methyl]-2-methylimidazole |
|---|---|
| PubChem CID | 129425471 |
| Molecular Formula | C13H23N3O3S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 1-[[(2S)-1-[(2R)-1-methoxypropan-2-yl]sulfonylpyrrolidin-2-yl]methyl]-2-methylimidazole |
| SMILES | COC[C@@H](C)S(=O)(=O)N1CCC[C@H]1Cn1ccnc1C |
| InChI | InChI=1S/C13H23N3O3S/c1-11(10-19-3)20(17,18)16-7-4-5-13(16)9-15-8-6-14-12(15)2/h6,8,11,13H,4-5,7,9-10H2,1-3H3/t11-,13+/m1/s1 |
| InChIKey | KPJVDYWOWSZUHV-YPMHNXCESA-N |
| XLogP | 1.02 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |