C16H14BrNO5 — CID 129425746
(1R,2R,3R,4R)-3-[(2-bromo-5-carboxyphenyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 129425746) has the molecular formula C16H14BrNO5 and a molecular weight of 380.19 g/mol. Its IUPAC name is (1R,2R,3R,4R)-3-[(2-bromo-5-carboxyphenyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (1R,2R,3R,4R)-3-[(2-bromo-5-carboxyphenyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 129425746 |
| Molecular Formula | C16H14BrNO5 |
| Molecular Weight | 380.19 g/mol |
| Exact Mass | 379.01 |
| IUPAC Name | (1R,2R,3R,4R)-3-[(2-bromo-5-carboxyphenyl)carbamoyl]bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(Br)c(NC(=O)[C@H]2[C@H](C(=O)O)[C@H]3C=C[C@H]2C3)c1 |
| InChI | InChI=1S/C16H14BrNO5/c17-10-4-3-9(15(20)21)6-11(10)18-14(19)12-7-1-2-8(5-7)13(12)16(22)23/h1-4,6-8,12-13H,5H2,(H,18,19)(H,20,21)(H,22,23)/t7-,8-,12+,13+/m0/s1 |
| InChIKey | OOIROZIWDSJDPB-GYBADROVSA-N |
| XLogP | 2.61 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.19 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|