C11H15N4O4P — CID 12942589
diethyl (1-pyridin-2-yl-1,2,4-triazol-3-yl) phosphate (PubChem CID 12942589) has the molecular formula C11H15N4O4P and a molecular weight of 298.24 g/mol. Its IUPAC name is diethyl (1-pyridin-2-yl-1,2,4-triazol-3-yl) phosphate.
| Compound Name | diethyl (1-pyridin-2-yl-1,2,4-triazol-3-yl) phosphate |
|---|---|
| PubChem CID | 12942589 |
| Molecular Formula | C11H15N4O4P |
| Molecular Weight | 298.24 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | diethyl (1-pyridin-2-yl-1,2,4-triazol-3-yl) phosphate |
| SMILES | CCOP(=O)(OCC)Oc1ncn(-c2ccccn2)n1 |
| InChI | InChI=1S/C11H15N4O4P/c1-3-17-20(16,18-4-2)19-11-13-9-15(14-11)10-7-5-6-8-12-10/h5-9H,3-4H2,1-2H3 |
| InChIKey | RVLZNYGWPDYBFV-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 88.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.24 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|