C15H28N2O — CID 129426171
5-[(3aR,9aS,9bS)-1,3,3a,4,6,7,8,9,9a,9b-decahydropyrrolo[3,4-a]indolizin-2-yl]pentan-1-ol (PubChem CID 129426171) has the molecular formula C15H28N2O and a molecular weight of 252.40 g/mol. Its IUPAC name is 5-[(3aR,9aS,9bS)-1,3,3a,4,6,7,8,9,9a,9b-decahydropyrrolo[3,4-a]indolizin-2-yl]pentan-1-ol.
| Compound Name | 5-[(3aR,9aS,9bS)-1,3,3a,4,6,7,8,9,9a,9b-decahydropyrrolo[3,4-a]indolizin-2-yl]pentan-1-ol |
|---|---|
| PubChem CID | 129426171 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | 5-[(3aR,9aS,9bS)-1,3,3a,4,6,7,8,9,9a,9b-decahydropyrrolo[3,4-a]indolizin-2-yl]pentan-1-ol |
| SMILES | OCCCCCN1C[C@@H]2CN3CCCC[C@H]3[C@@H]2C1 |
| InChI | InChI=1S/C15H28N2O/c18-9-5-1-3-7-16-10-13-11-17-8-4-2-6-15(17)14(13)12-16/h13-15,18H,1-12H2/t13-,14-,15+/m1/s1 |
| InChIKey | JUEBTNNNOCUEPL-KFWWJZLASA-N |
| XLogP | 1.57 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|