C18H23N3OS — CID 129427853
(1R,5R,6R)-N,7,7-trimethyl-N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]-2-oxabicyclo[3.2.0]heptan-6-amine (PubChem CID 129427853) has the molecular formula C18H23N3OS and a molecular weight of 329.47 g/mol. Its IUPAC name is (1R,5R,6R)-N,7,7-trimethyl-N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]-2-oxabicyclo[3.2.0]heptan-6-amine.
| Compound Name | (1R,5R,6R)-N,7,7-trimethyl-N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]-2-oxabicyclo[3.2.0]heptan-6-amine |
|---|---|
| PubChem CID | 129427853 |
| Molecular Formula | C18H23N3OS |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | (1R,5R,6R)-N,7,7-trimethyl-N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]-2-oxabicyclo[3.2.0]heptan-6-amine |
| SMILES | CN(Cc1csc(-c2ccccn2)n1)[C@@H]1[C@H]2CCO[C@H]2C1(C)C |
| InChI | InChI=1S/C18H23N3OS/c1-18(2)15(13-7-9-22-16(13)18)21(3)10-12-11-23-17(20-12)14-6-4-5-8-19-14/h4-6,8,11,13,15-16H,7,9-10H2,1-3H3/t13-,15-,16-/m1/s1 |
| InChIKey | LMHLJPDKPLJGFO-FVQBIDKESA-N |
| XLogP | 3.45 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |