C36H39N3O3 — CID 129428300
(1R,2S,10bS)-1-(adamantane-1-carbonyl)-2-(4-butoxy-3-methoxyphenyl)-2,10b-dihydro-1H-pyrrolo[2,1-a]isoquinoline-3,3-dicarbonitrile (PubChem CID 129428300) has the molecular formula C36H39N3O3 and a molecular weight of 561.73 g/mol. Its IUPAC name is (1R,2S,10bS)-1-(adamantane-1-carbonyl)-2-(4-butoxy-3-methoxyphenyl)-2,10b-dihydro-1H-pyrrolo[2,1-a]isoquinoline-3,3-dicarbonitrile.
| Compound Name | (1R,2S,10bS)-1-(adamantane-1-carbonyl)-2-(4-butoxy-3-methoxyphenyl)-2,10b-dihydro-1H-pyrrolo[2,1-a]isoquinoline-3,3-dicarbonitrile |
|---|---|
| PubChem CID | 129428300 |
| Molecular Formula | C36H39N3O3 |
| Molecular Weight | 561.73 g/mol |
| Exact Mass | 561.30 |
| IUPAC Name | (1R,2S,10bS)-1-(adamantane-1-carbonyl)-2-(4-butoxy-3-methoxyphenyl)-2,10b-dihydro-1H-pyrrolo[2,1-a]isoquinoline-3,3-dicarbonitrile |
| SMILES | CCCCOc1ccc([C@@H]2[C@@H](C(=O)C34CC5CC(CC(C5)C3)C4)[C@H]3c4ccccc4C=CN3C2(C#N)C#N)cc1OC |
| InChI | InChI=1S/C36H39N3O3/c1-3-4-13-42-29-10-9-27(17-30(29)41-2)32-31(34(40)35-18-23-14-24(19-35)16-25(15-23)20-35)33-28-8-6-5-7-26(28)11-12-39(33)36(32,21-37)22-38/h5-12,17,23-25,31-33H,3-4,13-16,18-20H2,1-2H3/t23?,24?,25?,31-,32-,33-,35?/m1/s1 |
| InChIKey | ZZELNUSLKLSRHE-UHUCZFSXSA-N |
| XLogP | 7.19 |
| TPSA | 86.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.73 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|