C13H25NO3 — CID 129428756
(3S)-N-[(2S,3S)-2-hydroxy-2,3-dimethylpentyl]oxane-3-carboxamide (PubChem CID 129428756) has the molecular formula C13H25NO3 and a molecular weight of 243.35 g/mol. Its IUPAC name is (3S)-N-[(2S,3S)-2-hydroxy-2,3-dimethylpentyl]oxane-3-carboxamide.
| Compound Name | (3S)-N-[(2S,3S)-2-hydroxy-2,3-dimethylpentyl]oxane-3-carboxamide |
|---|---|
| PubChem CID | 129428756 |
| Molecular Formula | C13H25NO3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.18 |
| IUPAC Name | (3S)-N-[(2S,3S)-2-hydroxy-2,3-dimethylpentyl]oxane-3-carboxamide |
| SMILES | CC[C@H](C)[C@](C)(O)CNC(=O)[C@H]1CCCOC1 |
| InChI | InChI=1S/C13H25NO3/c1-4-10(2)13(3,16)9-14-12(15)11-6-5-7-17-8-11/h10-11,16H,4-9H2,1-3H3,(H,14,15)/t10-,11-,13+/m0/s1 |
| InChIKey | BERCWUVYSUSEBW-GMXVVIOVSA-N |
| XLogP | 1.33 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |