C15H18N4OS — CID 129429409
N-[(3S,4S)-1-benzyl-4-methylpyrrolidin-3-yl]thiadiazole-4-carboxamide (PubChem CID 129429409) has the molecular formula C15H18N4OS and a molecular weight of 302.40 g/mol. Its IUPAC name is N-[(3S,4S)-1-benzyl-4-methylpyrrolidin-3-yl]thiadiazole-4-carboxamide.
| Compound Name | N-[(3S,4S)-1-benzyl-4-methylpyrrolidin-3-yl]thiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 129429409 |
| Molecular Formula | C15H18N4OS |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | N-[(3S,4S)-1-benzyl-4-methylpyrrolidin-3-yl]thiadiazole-4-carboxamide |
| SMILES | C[C@H]1CN(Cc2ccccc2)C[C@H]1NC(=O)c1csnn1 |
| InChI | InChI=1S/C15H18N4OS/c1-11-7-19(8-12-5-3-2-4-6-12)9-13(11)16-15(20)14-10-21-18-17-14/h2-6,10-11,13H,7-9H2,1H3,(H,16,20)/t11-,13+/m0/s1 |
| InChIKey | GIJHSXIROIXZRS-WCQYABFASA-N |
| XLogP | 1.79 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |