C15H27NO2 — CID 129429474
N-[(2R,6S)-2,6-dimethylcyclohexyl]-2-[(3R)-oxan-3-yl]acetamide (PubChem CID 129429474) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is N-[(2R,6S)-2,6-dimethylcyclohexyl]-2-[(3R)-oxan-3-yl]acetamide.
| Compound Name | N-[(2R,6S)-2,6-dimethylcyclohexyl]-2-[(3R)-oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 129429474 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | N-[(2R,6S)-2,6-dimethylcyclohexyl]-2-[(3R)-oxan-3-yl]acetamide |
| SMILES | C[C@@H]1CCC[C@H](C)C1NC(=O)C[C@H]1CCCOC1 |
| InChI | InChI=1S/C15H27NO2/c1-11-5-3-6-12(2)15(11)16-14(17)9-13-7-4-8-18-10-13/h11-13,15H,3-10H2,1-2H3,(H,16,17)/t11-,12+,13-,15?/m1/s1 |
| InChIKey | DBMXOJNSLUFWOD-WORDMNGFSA-N |
| XLogP | 2.74 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |