C16H27NO — CID 129429736
(1S,5S)-8-[[(1S,6R)-2,6-dimethylcyclohex-2-en-1-yl]methyl]-8-azabicyclo[3.2.1]octan-3-ol (PubChem CID 129429736) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is (1S,5S)-8-[[(1S,6R)-2,6-dimethylcyclohex-2-en-1-yl]methyl]-8-azabicyclo[3.2.1]octan-3-ol.
| Compound Name | (1S,5S)-8-[[(1S,6R)-2,6-dimethylcyclohex-2-en-1-yl]methyl]-8-azabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 129429736 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | (1S,5S)-8-[[(1S,6R)-2,6-dimethylcyclohex-2-en-1-yl]methyl]-8-azabicyclo[3.2.1]octan-3-ol |
| SMILES | CC1=CCC[C@@H](C)[C@@H]1CN1[C@H]2CC[C@H]1CC(O)C2 |
| InChI | InChI=1S/C16H27NO/c1-11-4-3-5-12(2)16(11)10-17-13-6-7-14(17)9-15(18)8-13/h4,12-16,18H,3,5-10H2,1-2H3/t12-,13+,14+,16-/m1/s1 |
| InChIKey | LSGBABGPNBPZEW-ORIJERBGSA-N |
| XLogP | 2.97 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|