C15H27NO — CID 129429754
(1R)-1-[(3R)-1-[[(1S,6S)-2,6-dimethylcyclohex-2-en-1-yl]methyl]pyrrolidin-3-yl]ethanol (PubChem CID 129429754) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is (1R)-1-[(3R)-1-[[(1S,6S)-2,6-dimethylcyclohex-2-en-1-yl]methyl]pyrrolidin-3-yl]ethanol.
| Compound Name | (1R)-1-[(3R)-1-[[(1S,6S)-2,6-dimethylcyclohex-2-en-1-yl]methyl]pyrrolidin-3-yl]ethanol |
|---|---|
| PubChem CID | 129429754 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | (1R)-1-[(3R)-1-[[(1S,6S)-2,6-dimethylcyclohex-2-en-1-yl]methyl]pyrrolidin-3-yl]ethanol |
| SMILES | CC1=CCC[C@H](C)[C@@H]1CN1CC[C@@H]([C@@H](C)O)C1 |
| InChI | InChI=1S/C15H27NO/c1-11-5-4-6-12(2)15(11)10-16-8-7-14(9-16)13(3)17/h5,12-15,17H,4,6-10H2,1-3H3/t12-,13+,14+,15+/m0/s1 |
| InChIKey | MPDKATDRFAEOKI-GBJTYRQASA-N |
| XLogP | 2.68 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|