About ethyl 2-[2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoylamino]acetate
ethyl 2-[2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoylamino]acetate (PubChem CID 12942999) has the molecular formula C18H18Cl2N2O5
and a molecular weight of 413.26 g/mol. Its IUPAC name is ethyl 2-[2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoylamino]acetate.
Molecular Properties
| Compound Name | ethyl 2-[2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoylamino]acetate |
| PubChem CID | 12942999 |
| Molecular Formula | C18H18Cl2N2O5 |
| Molecular Weight | 413.26 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | ethyl 2-[2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)C(C)Oc1ccc(Oc2ncc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C18H18Cl2N2O5/c1-3-25-16(23)10-21-17(24)11(2)26-13-4-6-14(7-5-13)27-18-15(20)8-12(19)9-22-18/h4-9,11H,3,10H2,1-2H3,(H,21,24) |
| InChIKey | KZDRZOFIRNIPBS-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.26 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 2-[2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoylamino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoylamino]acetate?
The IUPAC name of ethyl 2-[2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoylamino]acetate (CID 12942999) is ethyl 2-[2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoylamino]acetate.
What is the SMILES notation for ethyl 2-[2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoylamino]acetate?
The canonical SMILES for ethyl 2-[2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoylamino]acetate is CCOC(=O)CNC(=O)C(C)Oc1ccc(Oc2ncc(Cl)cc2Cl)cc1.
What is the InChIKey of ethyl 2-[2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoylamino]acetate?
The InChIKey is KZDRZOFIRNIPBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18Cl2N2O5/c1-3-25-16(23)10-21-17(24)11(2)26-13-4-6-14(7-5-13)27-18-15(20)8-12(19)9-22-18/h4-9,11H,3,10H2,1-2H3,(H,21,24).
What are the key properties of ethyl 2-[2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoylamino]acetate?
ethyl 2-[2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoylamino]acetate has a molecular weight of 413.26 g/mol, XLogP of 3.63, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[2-[4-[(3,5-dichloro-2-pyridinyl)oxy]phenoxy]propanoylamino]acetate is sourced from PubChem (CID 12942999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).