About 3-[(2S,4R)-1-(2-methoxy-5-methylphenyl)sulfonyl-4-methylpyrrolidin-2-yl]pyridine
3-[(2S,4R)-1-(2-methoxy-5-methylphenyl)sulfonyl-4-methylpyrrolidin-2-yl]pyridine (PubChem CID 129430032) has the molecular formula C18H22N2O3S
and a molecular weight of 346.45 g/mol. Its IUPAC name is 3-[(2S,4R)-1-(2-methoxy-5-methylphenyl)sulfonyl-4-methylpyrrolidin-2-yl]pyridine.
Molecular Properties
| Compound Name | 3-[(2S,4R)-1-(2-methoxy-5-methylphenyl)sulfonyl-4-methylpyrrolidin-2-yl]pyridine |
| PubChem CID | 129430032 |
| Molecular Formula | C18H22N2O3S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | 3-[(2S,4R)-1-(2-methoxy-5-methylphenyl)sulfonyl-4-methylpyrrolidin-2-yl]pyridine |
| SMILES | COc1ccc(C)cc1S(=O)(=O)N1C[C@H](C)C[C@H]1c1cccnc1 |
| InChI | InChI=1S/C18H22N2O3S/c1-13-6-7-17(23-3)18(10-13)24(21,22)20-12-14(2)9-16(20)15-5-4-8-19-11-15/h4-8,10-11,14,16H,9,12H2,1-3H3/t14-,16+/m1/s1 |
| InChIKey | CSKFNYTUMKSYLX-ZBFHGGJFSA-N |
| XLogP | 3.17 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(2S,4R)-1-(2-methoxy-5-methylphenyl)sulfonyl-4-methylpyrrolidin-2-yl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2S,4R)-1-(2-methoxy-5-methylphenyl)sulfonyl-4-methylpyrrolidin-2-yl]pyridine?
The IUPAC name of 3-[(2S,4R)-1-(2-methoxy-5-methylphenyl)sulfonyl-4-methylpyrrolidin-2-yl]pyridine (CID 129430032) is 3-[(2S,4R)-1-(2-methoxy-5-methylphenyl)sulfonyl-4-methylpyrrolidin-2-yl]pyridine.
What is the SMILES notation for 3-[(2S,4R)-1-(2-methoxy-5-methylphenyl)sulfonyl-4-methylpyrrolidin-2-yl]pyridine?
The canonical SMILES for 3-[(2S,4R)-1-(2-methoxy-5-methylphenyl)sulfonyl-4-methylpyrrolidin-2-yl]pyridine is COc1ccc(C)cc1S(=O)(=O)N1C[C@H](C)C[C@H]1c1cccnc1.
What is the InChIKey of 3-[(2S,4R)-1-(2-methoxy-5-methylphenyl)sulfonyl-4-methylpyrrolidin-2-yl]pyridine?
The InChIKey is CSKFNYTUMKSYLX-ZBFHGGJFSA-N. The full InChI is InChI=1S/C18H22N2O3S/c1-13-6-7-17(23-3)18(10-13)24(21,22)20-12-14(2)9-16(20)15-5-4-8-19-11-15/h4-8,10-11,14,16H,9,12H2,1-3H3/t14-,16+/m1/s1.
What are the key properties of 3-[(2S,4R)-1-(2-methoxy-5-methylphenyl)sulfonyl-4-methylpyrrolidin-2-yl]pyridine?
3-[(2S,4R)-1-(2-methoxy-5-methylphenyl)sulfonyl-4-methylpyrrolidin-2-yl]pyridine has a molecular weight of 346.45 g/mol, XLogP of 3.17, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2S,4R)-1-(2-methoxy-5-methylphenyl)sulfonyl-4-methylpyrrolidin-2-yl]pyridine is sourced from PubChem (CID 129430032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).