About [(3R,4S)-1-(1-propan-2-ylimidazol-4-yl)sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol
[(3R,4S)-1-(1-propan-2-ylimidazol-4-yl)sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol (PubChem CID 129430093) has the molecular formula C15H21N3O3S2
and a molecular weight of 355.49 g/mol. Its IUPAC name is [(3R,4S)-1-(1-propan-2-ylimidazol-4-yl)sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol.
Molecular Properties
| Compound Name | [(3R,4S)-1-(1-propan-2-ylimidazol-4-yl)sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol |
| PubChem CID | 129430093 |
| Molecular Formula | C15H21N3O3S2 |
| Molecular Weight | 355.49 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | [(3R,4S)-1-(1-propan-2-ylimidazol-4-yl)sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol |
| SMILES | CC(C)n1cnc(S(=O)(=O)N2C[C@H](CO)[C@@H](c3ccsc3)C2)c1 |
| InChI | InChI=1S/C15H21N3O3S2/c1-11(2)17-7-15(16-10-17)23(20,21)18-5-13(8-19)14(6-18)12-3-4-22-9-12/h3-4,7,9-11,13-14,19H,5-6,8H2,1-2H3/t13-,14-/m1/s1 |
| InChIKey | RDWXTXGHOYHODG-ZIAGYGMSSA-N |
| XLogP | 1.92 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.49 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [(3R,4S)-1-(1-propan-2-ylimidazol-4-yl)sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,4S)-1-(1-propan-2-ylimidazol-4-yl)sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol?
The IUPAC name of [(3R,4S)-1-(1-propan-2-ylimidazol-4-yl)sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol (CID 129430093) is [(3R,4S)-1-(1-propan-2-ylimidazol-4-yl)sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol.
What is the SMILES notation for [(3R,4S)-1-(1-propan-2-ylimidazol-4-yl)sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol?
The canonical SMILES for [(3R,4S)-1-(1-propan-2-ylimidazol-4-yl)sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol is CC(C)n1cnc(S(=O)(=O)N2C[C@H](CO)[C@@H](c3ccsc3)C2)c1.
What is the InChIKey of [(3R,4S)-1-(1-propan-2-ylimidazol-4-yl)sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol?
The InChIKey is RDWXTXGHOYHODG-ZIAGYGMSSA-N. The full InChI is InChI=1S/C15H21N3O3S2/c1-11(2)17-7-15(16-10-17)23(20,21)18-5-13(8-19)14(6-18)12-3-4-22-9-12/h3-4,7,9-11,13-14,19H,5-6,8H2,1-2H3/t13-,14-/m1/s1.
What are the key properties of [(3R,4S)-1-(1-propan-2-ylimidazol-4-yl)sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol?
[(3R,4S)-1-(1-propan-2-ylimidazol-4-yl)sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol has a molecular weight of 355.49 g/mol, XLogP of 1.92, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,4S)-1-(1-propan-2-ylimidazol-4-yl)sulfonyl-4-thiophen-3-ylpyrrolidin-3-yl]methanol is sourced from PubChem (CID 129430093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).