C19H27N3O3 — CID 129430194
(1S,2R,3R,6R,7R)-N-[(2-butoxy-3-pyridinyl)methyl]-2-hydroxy-4-azatricyclo[4.2.1.03,7]nonane-4-carboxamide (PubChem CID 129430194) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is (1S,2R,3R,6R,7R)-N-[(2-butoxy-3-pyridinyl)methyl]-2-hydroxy-4-azatricyclo[4.2.1.03,7]nonane-4-carboxamide.
| Compound Name | (1S,2R,3R,6R,7R)-N-[(2-butoxy-3-pyridinyl)methyl]-2-hydroxy-4-azatricyclo[4.2.1.03,7]nonane-4-carboxamide |
|---|---|
| PubChem CID | 129430194 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | (1S,2R,3R,6R,7R)-N-[(2-butoxy-3-pyridinyl)methyl]-2-hydroxy-4-azatricyclo[4.2.1.03,7]nonane-4-carboxamide |
| SMILES | CCCCOc1ncccc1CNC(=O)N1C[C@@H]2C[C@H]3C[C@H]2[C@@H]1[C@@H]3O |
| InChI | InChI=1S/C19H27N3O3/c1-2-3-7-25-18-12(5-4-6-20-18)10-21-19(24)22-11-14-8-13-9-15(14)16(22)17(13)23/h4-6,13-17,23H,2-3,7-11H2,1H3,(H,21,24)/t13-,14-,15+,16+,17+/m0/s1 |
| InChIKey | VBJHAALUBFBRDS-FIDHJVLJSA-N |
| XLogP | 2.17 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|