C15H29N3O — CID 129431224
[1-[(1S,3R)-2,2,3-tripropylcyclopropyl]ethylideneamino]urea (PubChem CID 129431224) has the molecular formula C15H29N3O and a molecular weight of 267.42 g/mol. Its IUPAC name is [1-[(1S,3R)-2,2,3-tripropylcyclopropyl]ethylideneamino]urea.
| Compound Name | [1-[(1S,3R)-2,2,3-tripropylcyclopropyl]ethylideneamino]urea |
|---|---|
| PubChem CID | 129431224 |
| Molecular Formula | C15H29N3O |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.23 |
| IUPAC Name | [1-[(1S,3R)-2,2,3-tripropylcyclopropyl]ethylideneamino]urea |
| SMILES | CCC[C@@H]1[C@H](C(C)=NNC(N)=O)C1(CCC)CCC |
| InChI | InChI=1S/C15H29N3O/c1-5-8-12-13(11(4)17-18-14(16)19)15(12,9-6-2)10-7-3/h12-13H,5-10H2,1-4H3,(H3,16,18,19)/t12-,13+/m1/s1 |
| InChIKey | YUXVMBQTOSZKNO-OLZOCXBDSA-N |
| XLogP | 3.66 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|