C13H12O5 — CID 129431381
(1S,2S,3R,4S,6S,7R,8R,9R,10S,13S)-1-hydroxy-12-oxo-11-oxahexacyclo[5.5.1.02,6.03,10.04,8.09,13]tridecane-10-carboxylic acid (PubChem CID 129431381) has the molecular formula C13H12O5 and a molecular weight of 248.23 g/mol. Its IUPAC name is (1S,2S,3R,4S,6S,7R,8R,9R,10S,13S)-1-hydroxy-12-oxo-11-oxahexacyclo[5.5.1.02,6.03,10.04,8.09,13]tridecane-10-carboxylic acid.
| Compound Name | (1S,2S,3R,4S,6S,7R,8R,9R,10S,13S)-1-hydroxy-12-oxo-11-oxahexacyclo[5.5.1.02,6.03,10.04,8.09,13]tridecane-10-carboxylic acid |
|---|---|
| PubChem CID | 129431381 |
| Molecular Formula | C13H12O5 |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | (1S,2S,3R,4S,6S,7R,8R,9R,10S,13S)-1-hydroxy-12-oxo-11-oxahexacyclo[5.5.1.02,6.03,10.04,8.09,13]tridecane-10-carboxylic acid |
| SMILES | O=C1O[C@@]2(C(=O)O)[C@@H]3[C@H]4C[C@H]5[C@@H]6[C@@H]4[C@@H]2[C@H]6[C@@]1(O)[C@@H]53 |
| InChI | InChI=1S/C13H12O5/c14-10(15)13-7-3-1-2-4-5(3)9(13)8(4)12(17,6(2)7)11(16)18-13/h2-9,17H,1H2,(H,14,15)/t2-,3-,4+,5+,6-,7+,8-,9+,12-,13-/m0/s1 |
| InChIKey | OBFKPXNRZKDWAS-GTOJLPHTSA-N |
| XLogP | -0.51 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |