C30H41NO5Si — CID 129431414
ethyl (1S,3R,5R,6R,8S,9S)-10-benzyl-9-hydroxy-5-[(3-methoxyphenyl)methyl]-3-trimethylsilyl-11-oxa-10-azatricyclo[6.2.1.01,6]undecane-8-carboxylate (PubChem CID 129431414) has the molecular formula C30H41NO5Si and a molecular weight of 523.75 g/mol. Its IUPAC name is ethyl (1S,3R,5R,6R,8S,9S)-10-benzyl-9-hydroxy-5-[(3-methoxyphenyl)methyl]-3-trimethylsilyl-11-oxa-10-azatricyclo[6.2.1.01,6]undecane-8-carboxylate.
| Compound Name | ethyl (1S,3R,5R,6R,8S,9S)-10-benzyl-9-hydroxy-5-[(3-methoxyphenyl)methyl]-3-trimethylsilyl-11-oxa-10-azatricyclo[6.2.1.01,6]undecane-8-carboxylate |
|---|---|
| PubChem CID | 129431414 |
| Molecular Formula | C30H41NO5Si |
| Molecular Weight | 523.75 g/mol |
| Exact Mass | 523.28 |
| IUPAC Name | ethyl (1S,3R,5R,6R,8S,9S)-10-benzyl-9-hydroxy-5-[(3-methoxyphenyl)methyl]-3-trimethylsilyl-11-oxa-10-azatricyclo[6.2.1.01,6]undecane-8-carboxylate |
| SMILES | CCOC(=O)[C@@]12C[C@@H]3[C@H](Cc4cccc(OC)c4)C[C@@H]([Si](C)(C)C)C[C@@]3(O1)N(Cc1ccccc1)[C@H]2O |
| InChI | InChI=1S/C30H41NO5Si/c1-6-35-28(33)29-19-26-23(15-22-13-10-14-24(16-22)34-2)17-25(37(3,4)5)18-30(26,36-29)31(27(29)32)20-21-11-8-7-9-12-21/h7-14,16,23,25-27,32H,6,15,17-20H2,1-5H3/t23-,25-,26-,27+,29+,30+/m1/s1 |
| InChIKey | QREULYCWNVUCKT-LEXPWTHCSA-N |
| XLogP | 5.22 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.75 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|