About N-[[(2S)-2-phenyl-2,3-dihydrochromen-4-ylidene]amino]pyridine-4-carboxamide
N-[[(2S)-2-phenyl-2,3-dihydrochromen-4-ylidene]amino]pyridine-4-carboxamide (PubChem CID 129432071) has the molecular formula C21H17N3O2
and a molecular weight of 343.39 g/mol. Its IUPAC name is N-[[(2S)-2-phenyl-2,3-dihydrochromen-4-ylidene]amino]pyridine-4-carboxamide.
Molecular Properties
| Compound Name | N-[[(2S)-2-phenyl-2,3-dihydrochromen-4-ylidene]amino]pyridine-4-carboxamide |
| PubChem CID | 129432071 |
| Molecular Formula | C21H17N3O2 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | N-[[(2S)-2-phenyl-2,3-dihydrochromen-4-ylidene]amino]pyridine-4-carboxamide |
| SMILES | O=C(NN=C1C[C@@H](c2ccccc2)Oc2ccccc21)c1ccncc1 |
| InChI | InChI=1S/C21H17N3O2/c25-21(16-10-12-22-13-11-16)24-23-18-14-20(15-6-2-1-3-7-15)26-19-9-5-4-8-17(18)19/h1-13,20H,14H2,(H,24,25)/t20-/m0/s1 |
| InChIKey | VKUGVGABPFGOCN-FQEVSTJZSA-N |
| XLogP | 3.74 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[[(2S)-2-phenyl-2,3-dihydrochromen-4-ylidene]amino]pyridine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(2S)-2-phenyl-2,3-dihydrochromen-4-ylidene]amino]pyridine-4-carboxamide?
The IUPAC name of N-[[(2S)-2-phenyl-2,3-dihydrochromen-4-ylidene]amino]pyridine-4-carboxamide (CID 129432071) is N-[[(2S)-2-phenyl-2,3-dihydrochromen-4-ylidene]amino]pyridine-4-carboxamide.
What is the SMILES notation for N-[[(2S)-2-phenyl-2,3-dihydrochromen-4-ylidene]amino]pyridine-4-carboxamide?
The canonical SMILES for N-[[(2S)-2-phenyl-2,3-dihydrochromen-4-ylidene]amino]pyridine-4-carboxamide is O=C(NN=C1C[C@@H](c2ccccc2)Oc2ccccc21)c1ccncc1.
What is the InChIKey of N-[[(2S)-2-phenyl-2,3-dihydrochromen-4-ylidene]amino]pyridine-4-carboxamide?
The InChIKey is VKUGVGABPFGOCN-FQEVSTJZSA-N. The full InChI is InChI=1S/C21H17N3O2/c25-21(16-10-12-22-13-11-16)24-23-18-14-20(15-6-2-1-3-7-15)26-19-9-5-4-8-17(18)19/h1-13,20H,14H2,(H,24,25)/t20-/m0/s1.
What are the key properties of N-[[(2S)-2-phenyl-2,3-dihydrochromen-4-ylidene]amino]pyridine-4-carboxamide?
N-[[(2S)-2-phenyl-2,3-dihydrochromen-4-ylidene]amino]pyridine-4-carboxamide has a molecular weight of 343.39 g/mol, XLogP of 3.74, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(2S)-2-phenyl-2,3-dihydrochromen-4-ylidene]amino]pyridine-4-carboxamide is sourced from PubChem (CID 129432071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).