C15H20N4O2S — CID 129432077
6-[2-[[(1S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylidene]hydrazinyl]pyridine-3-sulfonamide (PubChem CID 129432077) has the molecular formula C15H20N4O2S and a molecular weight of 320.42 g/mol. Its IUPAC name is 6-[2-[[(1S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylidene]hydrazinyl]pyridine-3-sulfonamide.
| Compound Name | 6-[2-[[(1S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylidene]hydrazinyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 129432077 |
| Molecular Formula | C15H20N4O2S |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 6-[2-[[(1S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylidene]hydrazinyl]pyridine-3-sulfonamide |
| SMILES | CC1(C)[C@H]2CC=C(C=NNc3ccc(S(N)(=O)=O)cn3)[C@H]1C2 |
| InChI | InChI=1S/C15H20N4O2S/c1-15(2)11-4-3-10(13(15)7-11)8-18-19-14-6-5-12(9-17-14)22(16,20)21/h3,5-6,8-9,11,13H,4,7H2,1-2H3,(H,17,19)(H2,16,20,21)/t11-,13+/m0/s1 |
| InChIKey | WMCVBUPXMNCKEL-WCQYABFASA-N |
| XLogP | 2.12 |
| TPSA | 97.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|