C19H30N4O2 — CID 129432132
1-[[(3S,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-3-[(1R)-2-methyl-1-(3-methyl-2-pyridinyl)propyl]urea (PubChem CID 129432132) has the molecular formula C19H30N4O2 and a molecular weight of 346.48 g/mol. Its IUPAC name is 1-[[(3S,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-3-[(1R)-2-methyl-1-(3-methyl-2-pyridinyl)propyl]urea.
| Compound Name | 1-[[(3S,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-3-[(1R)-2-methyl-1-(3-methyl-2-pyridinyl)propyl]urea |
|---|---|
| PubChem CID | 129432132 |
| Molecular Formula | C19H30N4O2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | 1-[[(3S,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl]methyl]-3-[(1R)-2-methyl-1-(3-methyl-2-pyridinyl)propyl]urea |
| SMILES | Cc1cccnc1[C@H](NC(=O)NC[C@H]1CN2CCC[C@H]2CO1)C(C)C |
| InChI | InChI=1S/C19H30N4O2/c1-13(2)17(18-14(3)6-4-8-20-18)22-19(24)21-10-16-11-23-9-5-7-15(23)12-25-16/h4,6,8,13,15-17H,5,7,9-12H2,1-3H3,(H2,21,22,24)/t15-,16-,17+/m0/s1 |
| InChIKey | CMHAJPQCARIRKD-YESZJQIVSA-N |
| XLogP | 2.25 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |