C19H24N4S — CID 129432524
1-cyclopropyl-1-methyl-2-[[(6S)-6-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]methyl]guanidine (PubChem CID 129432524) has the molecular formula C19H24N4S and a molecular weight of 340.50 g/mol. Its IUPAC name is 1-cyclopropyl-1-methyl-2-[[(6S)-6-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]methyl]guanidine.
| Compound Name | 1-cyclopropyl-1-methyl-2-[[(6S)-6-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]methyl]guanidine |
|---|---|
| PubChem CID | 129432524 |
| Molecular Formula | C19H24N4S |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 1-cyclopropyl-1-methyl-2-[[(6S)-6-phenyl-4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl]methyl]guanidine |
| SMILES | CN(/C(N)=N/Cc1nc2c(s1)C[C@@H](c1ccccc1)CC2)C1CC1 |
| InChI | InChI=1S/C19H24N4S/c1-23(15-8-9-15)19(20)21-12-18-22-16-10-7-14(11-17(16)24-18)13-5-3-2-4-6-13/h2-6,14-15H,7-12H2,1H3,(H2,20,21)/t14-/m0/s1 |
| InChIKey | DPYPKAJQBJSOLY-AWEZNQCLSA-N |
| XLogP | 3.32 |
| TPSA | 54.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|