C19H25N3O3 — CID 129433234
N'-[(1R)-1-(5-ethylfuran-2-yl)-2,2-dimethylpropyl]-N-(2-methyl-3-pyridinyl)oxamide (PubChem CID 129433234) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is N'-[(1R)-1-(5-ethylfuran-2-yl)-2,2-dimethylpropyl]-N-(2-methyl-3-pyridinyl)oxamide.
| Compound Name | N'-[(1R)-1-(5-ethylfuran-2-yl)-2,2-dimethylpropyl]-N-(2-methyl-3-pyridinyl)oxamide |
|---|---|
| PubChem CID | 129433234 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | N'-[(1R)-1-(5-ethylfuran-2-yl)-2,2-dimethylpropyl]-N-(2-methyl-3-pyridinyl)oxamide |
| SMILES | CCc1ccc([C@H](NC(=O)C(=O)Nc2cccnc2C)C(C)(C)C)o1 |
| InChI | InChI=1S/C19H25N3O3/c1-6-13-9-10-15(25-13)16(19(3,4)5)22-18(24)17(23)21-14-8-7-11-20-12(14)2/h7-11,16H,6H2,1-5H3,(H,21,23)(H,22,24)/t16-/m0/s1 |
| InChIKey | KXIBJCRQXATRBB-INIZCTEOSA-N |
| XLogP | 3.39 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|