About 2-benzylimino-1,2-diphenylethanone
2-benzylimino-1,2-diphenylethanone (PubChem CID 12943333) has the molecular formula C21H17NO
and a molecular weight of 299.37 g/mol. Its IUPAC name is 2-benzylimino-1,2-diphenylethanone.
Molecular Properties
| Compound Name | 2-benzylimino-1,2-diphenylethanone |
| PubChem CID | 12943333 |
| Molecular Formula | C21H17NO |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 2-benzylimino-1,2-diphenylethanone |
| SMILES | O=C(/C(=N/Cc1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H17NO/c23-21(19-14-8-3-9-15-19)20(18-12-6-2-7-13-18)22-16-17-10-4-1-5-11-17/h1-15H,16H2/b22-20+ |
| InChIKey | ITWXMSXAVAQNEQ-LSDHQDQOSA-N |
| XLogP | 4.56 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-benzylimino-1,2-diphenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzylimino-1,2-diphenylethanone?
The IUPAC name of 2-benzylimino-1,2-diphenylethanone (CID 12943333) is 2-benzylimino-1,2-diphenylethanone.
What is the SMILES notation for 2-benzylimino-1,2-diphenylethanone?
The canonical SMILES for 2-benzylimino-1,2-diphenylethanone is O=C(/C(=N/Cc1ccccc1)c1ccccc1)c1ccccc1.
What is the InChIKey of 2-benzylimino-1,2-diphenylethanone?
The InChIKey is ITWXMSXAVAQNEQ-LSDHQDQOSA-N. The full InChI is InChI=1S/C21H17NO/c23-21(19-14-8-3-9-15-19)20(18-12-6-2-7-13-18)22-16-17-10-4-1-5-11-17/h1-15H,16H2/b22-20+.
What are the key properties of 2-benzylimino-1,2-diphenylethanone?
2-benzylimino-1,2-diphenylethanone has a molecular weight of 299.37 g/mol, XLogP of 4.56, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzylimino-1,2-diphenylethanone is sourced from PubChem (CID 12943333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).