C19H30N4O2 — CID 129433350
1-[[6-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-3-pyridinyl]methyl]-3-[(3S)-hex-5-en-3-yl]urea (PubChem CID 129433350) has the molecular formula C19H30N4O2 and a molecular weight of 346.48 g/mol. Its IUPAC name is 1-[[6-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-3-pyridinyl]methyl]-3-[(3S)-hex-5-en-3-yl]urea.
| Compound Name | 1-[[6-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-3-pyridinyl]methyl]-3-[(3S)-hex-5-en-3-yl]urea |
|---|---|
| PubChem CID | 129433350 |
| Molecular Formula | C19H30N4O2 |
| Molecular Weight | 346.48 g/mol |
| Exact Mass | 346.24 |
| IUPAC Name | 1-[[6-[(2R,6R)-2,6-dimethylmorpholin-4-yl]-3-pyridinyl]methyl]-3-[(3S)-hex-5-en-3-yl]urea |
| SMILES | C=CC[C@H](CC)NC(=O)NCc1ccc(N2C[C@@H](C)O[C@H](C)C2)nc1 |
| InChI | InChI=1S/C19H30N4O2/c1-5-7-17(6-2)22-19(24)21-11-16-8-9-18(20-10-16)23-12-14(3)25-15(4)13-23/h5,8-10,14-15,17H,1,6-7,11-13H2,2-4H3,(H2,21,22,24)/t14-,15-,17+/m1/s1 |
| InChIKey | MNBWLVIEFOTGLF-INMHGKMJSA-N |
| XLogP | 2.85 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.48 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|