About N-[(1S,2R)-2-methoxycyclopentyl]-1-methylsulfonylcyclobutane-1-carboxamide
N-[(1S,2R)-2-methoxycyclopentyl]-1-methylsulfonylcyclobutane-1-carboxamide (PubChem CID 129433376) has the molecular formula C12H21NO4S
and a molecular weight of 275.37 g/mol. Its IUPAC name is N-[(1S,2R)-2-methoxycyclopentyl]-1-methylsulfonylcyclobutane-1-carboxamide.
Molecular Properties
| Compound Name | N-[(1S,2R)-2-methoxycyclopentyl]-1-methylsulfonylcyclobutane-1-carboxamide |
| PubChem CID | 129433376 |
| Molecular Formula | C12H21NO4S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | N-[(1S,2R)-2-methoxycyclopentyl]-1-methylsulfonylcyclobutane-1-carboxamide |
| SMILES | CO[C@@H]1CCC[C@@H]1NC(=O)C1(S(C)(=O)=O)CCC1 |
| InChI | InChI=1S/C12H21NO4S/c1-17-10-6-3-5-9(10)13-11(14)12(7-4-8-12)18(2,15)16/h9-10H,3-8H2,1-2H3,(H,13,14)/t9-,10+/m0/s1 |
| InChIKey | MVBIOOZXAMHCSU-VHSXEESVSA-N |
| XLogP | 0.64 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(1S,2R)-2-methoxycyclopentyl]-1-methylsulfonylcyclobutane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1S,2R)-2-methoxycyclopentyl]-1-methylsulfonylcyclobutane-1-carboxamide?
The IUPAC name of N-[(1S,2R)-2-methoxycyclopentyl]-1-methylsulfonylcyclobutane-1-carboxamide (CID 129433376) is N-[(1S,2R)-2-methoxycyclopentyl]-1-methylsulfonylcyclobutane-1-carboxamide.
What is the SMILES notation for N-[(1S,2R)-2-methoxycyclopentyl]-1-methylsulfonylcyclobutane-1-carboxamide?
The canonical SMILES for N-[(1S,2R)-2-methoxycyclopentyl]-1-methylsulfonylcyclobutane-1-carboxamide is CO[C@@H]1CCC[C@@H]1NC(=O)C1(S(C)(=O)=O)CCC1.
What is the InChIKey of N-[(1S,2R)-2-methoxycyclopentyl]-1-methylsulfonylcyclobutane-1-carboxamide?
The InChIKey is MVBIOOZXAMHCSU-VHSXEESVSA-N. The full InChI is InChI=1S/C12H21NO4S/c1-17-10-6-3-5-9(10)13-11(14)12(7-4-8-12)18(2,15)16/h9-10H,3-8H2,1-2H3,(H,13,14)/t9-,10+/m0/s1.
What are the key properties of N-[(1S,2R)-2-methoxycyclopentyl]-1-methylsulfonylcyclobutane-1-carboxamide?
N-[(1S,2R)-2-methoxycyclopentyl]-1-methylsulfonylcyclobutane-1-carboxamide has a molecular weight of 275.37 g/mol, XLogP of 0.64, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1S,2R)-2-methoxycyclopentyl]-1-methylsulfonylcyclobutane-1-carboxamide is sourced from PubChem (CID 129433376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).