C14H19F3N2O2 — CID 129433824
(2R)-N-(4-hydroxy-3,5-dimethylphenyl)-2-[methyl(2,2,2-trifluoroethyl)amino]propanamide (PubChem CID 129433824) has the molecular formula C14H19F3N2O2 and a molecular weight of 304.31 g/mol. Its IUPAC name is (2R)-N-(4-hydroxy-3,5-dimethylphenyl)-2-[methyl(2,2,2-trifluoroethyl)amino]propanamide.
| Compound Name | (2R)-N-(4-hydroxy-3,5-dimethylphenyl)-2-[methyl(2,2,2-trifluoroethyl)amino]propanamide |
|---|---|
| PubChem CID | 129433824 |
| Molecular Formula | C14H19F3N2O2 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | (2R)-N-(4-hydroxy-3,5-dimethylphenyl)-2-[methyl(2,2,2-trifluoroethyl)amino]propanamide |
| SMILES | Cc1cc(NC(=O)[C@@H](C)N(C)CC(F)(F)F)cc(C)c1O |
| InChI | InChI=1S/C14H19F3N2O2/c1-8-5-11(6-9(2)12(8)20)18-13(21)10(3)19(4)7-14(15,16)17/h5-6,10,20H,7H2,1-4H3,(H,18,21)/t10-/m1/s1 |
| InChIKey | TUTUMZPOZRNBDN-SNVBAGLBSA-N |
| XLogP | 2.83 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|