C17H22BrN3O3 — CID 129434418
[2-oxo-2-[2-[(1S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]hydrazinyl]ethyl] 4-bromo-1H-pyrrole-2-carboxylate (PubChem CID 129434418) has the molecular formula C17H22BrN3O3 and a molecular weight of 396.29 g/mol. Its IUPAC name is [2-oxo-2-[2-[(1S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]hydrazinyl]ethyl] 4-bromo-1H-pyrrole-2-carboxylate.
| Compound Name | [2-oxo-2-[2-[(1S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]hydrazinyl]ethyl] 4-bromo-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 129434418 |
| Molecular Formula | C17H22BrN3O3 |
| Molecular Weight | 396.29 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | [2-oxo-2-[2-[(1S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]hydrazinyl]ethyl] 4-bromo-1H-pyrrole-2-carboxylate |
| SMILES | CC1(C)[C@H]2CC[C@]1(C)C(=NNC(=O)COC(=O)c1cc(Br)c[nH]1)C2 |
| InChI | InChI=1S/C17H22BrN3O3/c1-16(2)10-4-5-17(16,3)13(6-10)20-21-14(22)9-24-15(23)12-7-11(18)8-19-12/h7-8,10,19H,4-6,9H2,1-3H3,(H,21,22)/t10-,17+/m0/s1 |
| InChIKey | YZDNJWPZCFMARE-DYZYQPBXSA-N |
| XLogP | 3.25 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.29 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|